C26H24F3N3O5S2 — CID 142973575
methyl 4-[[(E)-4-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]-3-methylpent-3-enyl]carbamothioylamino]-2-nitrobenzoate (PubChem CID 142973575) has the molecular formula C26H24F3N3O5S2 and a molecular weight of 579.62 g/mol. Its IUPAC name is methyl 4-[[(E)-4-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]-3-methylpent-3-enyl]carbamothioylamino]-2-nitrobenzoate.
| Compound Name | methyl 4-[[(E)-4-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]-3-methylpent-3-enyl]carbamothioylamino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 142973575 |
| Molecular Formula | C26H24F3N3O5S2 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | methyl 4-[[(E)-4-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]-3-methylpent-3-enyl]carbamothioylamino]-2-nitrobenzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NCC/C(C)=C(\C)c2csc(-c3ccc(C(F)(F)F)cc3)c2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24F3N3O5S2/c1-14(10-11-30-25(38)31-18-8-9-19(24(34)37-3)21(12-18)32(35)36)15(2)20-13-39-23(22(20)33)16-4-6-17(7-5-16)26(27,28)29/h4-9,12-13,33H,10-11H2,1-3H3,(H2,30,31,38)/b15-14+ |
| InChIKey | RTOCEPINXRODEF-CCEZHUSRSA-N |
| XLogP | 7.00 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|