C21H18F3N3O3S3 — CID 58209774
N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]-2-(4-sulfamoylphenyl)ethanethioamide (PubChem CID 58209774) has the molecular formula C21H18F3N3O3S3 and a molecular weight of 513.59 g/mol. Its IUPAC name is N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]-2-(4-sulfamoylphenyl)ethanethioamide.
| Compound Name | N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]-2-(4-sulfamoylphenyl)ethanethioamide |
|---|---|
| PubChem CID | 58209774 |
| Molecular Formula | C21H18F3N3O3S3 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]-2-(4-sulfamoylphenyl)ethanethioamide |
| SMILES | C/C(=N\NC(=S)Cc1ccc(S(N)(=O)=O)cc1)c1csc(-c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C21H18F3N3O3S3/c1-12(26-27-18(31)10-13-2-8-16(9-3-13)33(25,29)30)17-11-32-20(19(17)28)14-4-6-15(7-5-14)21(22,23)24/h2-9,11,28H,10H2,1H3,(H,27,31)(H2,25,29,30)/b26-12+ |
| InChIKey | VGKRZGPIWBFBEW-RPPGKUMJSA-N |
| XLogP | 4.67 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|