C25H25N3O6S — CID 173184146
4-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-3-methyl-2-nitrobenzoic acid (PubChem CID 173184146) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 4-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-3-methyl-2-nitrobenzoic acid.
| Compound Name | 4-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-3-methyl-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 173184146 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 4-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-3-methyl-2-nitrobenzoic acid |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)O)c([N+](=O)[O-])c1C)c1csc(-c2ccc(C(C)(C)C)cc2)c1O |
| InChI | InChI=1S/C25H25N3O6S/c1-13-17(10-11-18(24(31)32)20(13)28(33)34)23(30)27-26-14(2)19-12-35-22(21(19)29)15-6-8-16(9-7-15)25(3,4)5/h6-12,29H,1-5H3,(H,27,30)(H,31,32) |
| InChIKey | ZQQDOCZIRVNGDN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|