C27H21F3N4O4S2 — CID 42634489
5-N-[(4-carbamoylphenyl)methyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide (PubChem CID 42634489) has the molecular formula C27H21F3N4O4S2 and a molecular weight of 586.62 g/mol. Its IUPAC name is 5-N-[(4-carbamoylphenyl)methyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide.
| Compound Name | 5-N-[(4-carbamoylphenyl)methyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 42634489 |
| Molecular Formula | C27H21F3N4O4S2 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 5-N-[(4-carbamoylphenyl)methyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)NCc2ccc(C(N)=O)cc2)s1)c1csc(-c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C27H21F3N4O4S2/c1-14(19-13-39-23(22(19)35)16-6-8-18(9-7-16)27(28,29)30)33-34-26(38)21-11-10-20(40-21)25(37)32-12-15-2-4-17(5-3-15)24(31)36/h2-11,13,35H,12H2,1H3,(H2,31,36)(H,32,37)(H,34,38)/b33-14+ |
| InChIKey | QYIOYTMNSQFXBP-ZHSUKTGHSA-N |
| XLogP | 5.38 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|