C28H23F3N4O5S2 — CID 59539261
5-N-[1-(4-carbamoylphenyl)ethyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide (PubChem CID 59539261) has the molecular formula C28H23F3N4O5S2 and a molecular weight of 616.64 g/mol. Its IUPAC name is 5-N-[1-(4-carbamoylphenyl)ethyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide.
| Compound Name | 5-N-[1-(4-carbamoylphenyl)ethyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 59539261 |
| Molecular Formula | C28H23F3N4O5S2 |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 5-N-[1-(4-carbamoylphenyl)ethyl]-2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)NC(C)c2ccc(C(N)=O)cc2)s1)c1csc(-c2ccc(OC(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C28H23F3N4O5S2/c1-14(16-3-5-18(6-4-16)25(32)37)33-26(38)21-11-12-22(42-21)27(39)35-34-15(2)20-13-41-24(23(20)36)17-7-9-19(10-8-17)40-28(29,30)31/h3-14,36H,1-2H3,(H2,32,37)(H,33,38)(H,35,39)/b34-15+ |
| InChIKey | HKWJLLOBBQMEJX-PUHLOBNQSA-N |
| XLogP | 5.82 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|