C21H18F3N3O5S — CID 59693194
3-amino-4-[[1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylamino]carbamoyl]benzoic acid (PubChem CID 59693194) has the molecular formula C21H18F3N3O5S and a molecular weight of 481.45 g/mol. Its IUPAC name is 3-amino-4-[[1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylamino]carbamoyl]benzoic acid.
| Compound Name | 3-amino-4-[[1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylamino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59693194 |
| Molecular Formula | C21H18F3N3O5S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 3-amino-4-[[1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylamino]carbamoyl]benzoic acid |
| SMILES | CC(NNC(=O)c1ccc(C(=O)O)cc1N)c1csc(-c2ccc(OC(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C21H18F3N3O5S/c1-10(26-27-19(29)14-7-4-12(20(30)31)8-16(14)25)15-9-33-18(17(15)28)11-2-5-13(6-3-11)32-21(22,23)24/h2-10,26,28H,25H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | CTONDIOJPQCRNR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|