C20H16ClN3O4S — CID 59693126
3-amino-4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]benzoic acid (PubChem CID 59693126) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is 3-amino-4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]benzoic acid.
| Compound Name | 3-amino-4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59693126 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 3-amino-4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]benzoic acid |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)O)cc1N)c1csc(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C20H16ClN3O4S/c1-10(15-9-29-18(17(15)25)11-2-5-13(21)6-3-11)23-24-19(26)14-7-4-12(20(27)28)8-16(14)22/h2-9,25H,22H2,1H3,(H,24,26)(H,27,28)/b23-10+ |
| InChIKey | DQRGGGQVEYECSC-AUEPDCJTSA-N |
| XLogP | 4.21 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|