C22H18ClNO3S2 — CID 58209814
3-[3-[1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid (PubChem CID 58209814) has the molecular formula C22H18ClNO3S2 and a molecular weight of 443.98 g/mol. Its IUPAC name is 3-[3-[1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid.
| Compound Name | 3-[3-[1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid |
|---|---|
| PubChem CID | 58209814 |
| Molecular Formula | C22H18ClNO3S2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 3-[3-[1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid |
| SMILES | C/C(=N\CC(=S)Cc1cccc(C(=O)O)c1)c1csc(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C22H18ClNO3S2/c1-13(19-12-29-21(20(19)25)15-5-7-17(23)8-6-15)24-11-18(28)10-14-3-2-4-16(9-14)22(26)27/h2-9,12,25H,10-11H2,1H3,(H,26,27)/b24-13+ |
| InChIKey | HIJQQKDYNQMJRZ-ZMOGYAJESA-N |
| XLogP | 5.89 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|