C22H16Cl3NO3S2 — CID 58209676
2-chloro-4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid (PubChem CID 58209676) has the molecular formula C22H16Cl3NO3S2 and a molecular weight of 512.87 g/mol. Its IUPAC name is 2-chloro-4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid.
| Compound Name | 2-chloro-4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid |
|---|---|
| PubChem CID | 58209676 |
| Molecular Formula | C22H16Cl3NO3S2 |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 510.96 |
| IUPAC Name | 2-chloro-4-[3-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]benzoic acid |
| SMILES | C/C(=N\CC(=S)Cc1ccc(C(=O)O)c(Cl)c1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C22H16Cl3NO3S2/c1-11(16-10-31-21(20(16)27)13-3-5-17(23)19(25)8-13)26-9-14(30)6-12-2-4-15(22(28)29)18(24)7-12/h2-5,7-8,10,27H,6,9H2,1H3,(H,28,29)/b26-11+ |
| InChIKey | JMRWEFASPQRCHY-KBKYJPHKSA-N |
| XLogP | 7.20 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|