C18H19Cl2N3O2S2 — CID 87656494
N-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-4-hydroxypiperidine-1-carbothioamide (PubChem CID 87656494) has the molecular formula C18H19Cl2N3O2S2 and a molecular weight of 444.41 g/mol. Its IUPAC name is N-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-4-hydroxypiperidine-1-carbothioamide.
| Compound Name | N-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-4-hydroxypiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 87656494 |
| Molecular Formula | C18H19Cl2N3O2S2 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | N-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-4-hydroxypiperidine-1-carbothioamide |
| SMILES | C/C(=N/NC(=S)N1CCC(O)CC1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C18H19Cl2N3O2S2/c1-10(21-22-18(26)23-6-4-12(24)5-7-23)13-9-27-17(16(13)25)11-2-3-14(19)15(20)8-11/h2-3,8-9,12,24-25H,4-7H2,1H3,(H,22,26)/b21-10- |
| InChIKey | BFCBUWAZNLOIFS-FBHDLOMBSA-N |
| XLogP | 4.48 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|