C23H19Cl3N4O4S2 — CID 143240535
2-chloro-4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-(ethylcarbamoyloxy)thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid (PubChem CID 143240535) has the molecular formula C23H19Cl3N4O4S2 and a molecular weight of 585.92 g/mol. Its IUPAC name is 2-chloro-4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-(ethylcarbamoyloxy)thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-(ethylcarbamoyloxy)thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 143240535 |
| Molecular Formula | C23H19Cl3N4O4S2 |
| Molecular Weight | 585.92 g/mol |
| Exact Mass | 583.99 |
| IUPAC Name | 2-chloro-4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-(ethylcarbamoyloxy)thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
| SMILES | CCNC(=O)Oc1c(/C(C)=N/NC(=S)Nc2ccc(C(=O)O)c(Cl)c2)csc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H19Cl3N4O4S2/c1-3-27-23(33)34-19-15(10-36-20(19)12-4-7-16(24)18(26)8-12)11(2)29-30-22(35)28-13-5-6-14(21(31)32)17(25)9-13/h4-10H,3H2,1-2H3,(H,27,33)(H,31,32)(H2,28,30,35)/b29-11+ |
| InChIKey | PBFVQKIJEVAGFU-VPUKRXIYSA-N |
| XLogP | 6.89 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.92 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|