C20H15Cl2N3O3S2 — CID 87886138
2-chloro-4-[[2-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid (PubChem CID 87886138) has the molecular formula C20H15Cl2N3O3S2 and a molecular weight of 480.40 g/mol. Its IUPAC name is 2-chloro-4-[[2-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[2-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 87886138 |
| Molecular Formula | C20H15Cl2N3O3S2 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | 2-chloro-4-[[2-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)NN=CCc2csc(-c3ccc(Cl)cc3)c2O)cc1Cl |
| InChI | InChI=1S/C20H15Cl2N3O3S2/c21-13-3-1-11(2-4-13)18-17(26)12(10-30-18)7-8-23-25-20(29)24-14-5-6-15(19(27)28)16(22)9-14/h1-6,8-10,26H,7H2,(H,27,28)(H2,24,25,29) |
| InChIKey | YOZJAYOVSHHXTN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|