C16H11Cl3N2O4S — CID 1328323
2-chloro-4-[[2-(2,4-dichlorophenoxy)acetyl]carbamothioylamino]benzoic acid (PubChem CID 1328323) has the molecular formula C16H11Cl3N2O4S and a molecular weight of 433.70 g/mol. Its IUPAC name is 2-chloro-4-[[2-(2,4-dichlorophenoxy)acetyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[2-(2,4-dichlorophenoxy)acetyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 1328323 |
| Molecular Formula | C16H11Cl3N2O4S |
| Molecular Weight | 433.70 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 2-chloro-4-[[2-(2,4-dichlorophenoxy)acetyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC(=S)Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl3N2O4S/c17-8-1-4-13(12(19)5-8)25-7-14(22)21-16(26)20-9-2-3-10(15(23)24)11(18)6-9/h1-6H,7H2,(H,23,24)(H2,20,21,22,26) |
| InChIKey | MEYMHADGYWXDKQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|