C19H14Cl2IN3O4S3 — CID 172940175
iodo 4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzenesulfonate (PubChem CID 172940175) has the molecular formula C19H14Cl2IN3O4S3 and a molecular weight of 642.35 g/mol. Its IUPAC name is iodo 4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzenesulfonate.
| Compound Name | iodo 4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzenesulfonate |
|---|---|
| PubChem CID | 172940175 |
| Molecular Formula | C19H14Cl2IN3O4S3 |
| Molecular Weight | 642.35 g/mol |
| Exact Mass | 640.86 |
| IUPAC Name | iodo 4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]benzenesulfonate |
| SMILES | C/C(=N\NC(=S)Nc1ccc(S(=O)(=O)OI)cc1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C19H14Cl2IN3O4S3/c1-10(14-9-31-18(17(14)26)11-2-7-15(20)16(21)8-11)24-25-19(30)23-12-3-5-13(6-4-12)32(27,28)29-22/h2-9,26H,1H3,(H2,23,25,30)/b24-10+ |
| InChIKey | VIAGHYNPWVUWQI-YSURURNPSA-N |
| XLogP | 6.19 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|