C19H17ClN4O3S3 — CID 59693252
1-[(E)-1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 59693252) has the molecular formula C19H17ClN4O3S3 and a molecular weight of 481.02 g/mol. Its IUPAC name is 1-[(E)-1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(E)-1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 59693252 |
| Molecular Formula | C19H17ClN4O3S3 |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | 1-[(E)-1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | C/C(=N\NC(=S)Nc1ccc(S(N)(=O)=O)cc1)c1csc(-c2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C19H17ClN4O3S3/c1-11(16-10-29-18(17(16)25)12-3-2-4-13(20)9-12)23-24-19(28)22-14-5-7-15(8-6-14)30(21,26)27/h2-10,25H,1H3,(H2,21,26,27)(H2,22,24,28)/b23-11+ |
| InChIKey | PDADHSPKORIPSW-FOKLQQMPSA-N |
| XLogP | 4.13 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|