C14H15N5O2S2 — CID 5464849
1-[(Z)-1-pyridin-2-ylethylideneamino]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 5464849) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[(Z)-1-pyridin-2-ylethylideneamino]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(Z)-1-pyridin-2-ylethylideneamino]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 5464849 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[(Z)-1-pyridin-2-ylethylideneamino]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | C/C(=N/NC(=S)Nc1ccc(S(N)(=O)=O)cc1)c1ccccn1 |
| InChI | InChI=1S/C14H15N5O2S2/c1-10(13-4-2-3-9-16-13)18-19-14(22)17-11-5-7-12(8-6-11)23(15,20)21/h2-9H,1H3,(H2,15,20,21)(H2,17,19,22)/b18-10- |
| InChIKey | BCFCPOLFSAERRD-ZDLGFXPLSA-N |
| XLogP | 1.44 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|