C14H13N5O5S2 — CID 3627608
5-nitro-2-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]benzenesulfonic acid (PubChem CID 3627608) has the molecular formula C14H13N5O5S2 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-nitro-2-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]benzenesulfonic acid.
| Compound Name | 5-nitro-2-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 3627608 |
| Molecular Formula | C14H13N5O5S2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 5-nitro-2-[(1-pyridin-2-ylethylideneamino)carbamothioylamino]benzenesulfonic acid |
| SMILES | CC(=NNC(=S)Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)O)c1ccccn1 |
| InChI | InChI=1S/C14H13N5O5S2/c1-9(11-4-2-3-7-15-11)17-18-14(25)16-12-6-5-10(19(20)21)8-13(12)26(22,23)24/h2-8H,1H3,(H2,16,18,25)(H,22,23,24) |
| InChIKey | NQXJJTJTMSOYHA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|