C25H26N4O5S2 — CID 59693205
methyl 4-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoate (PubChem CID 59693205) has the molecular formula C25H26N4O5S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is methyl 4-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoate.
| Compound Name | methyl 4-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 59693205 |
| Molecular Formula | C25H26N4O5S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | methyl 4-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoate |
| SMILES | COC(=O)c1ccc(NC(=S)N/N=C(\C)c2csc(-c3ccc(C(C)(C)C)cc3)c2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H26N4O5S2/c1-14(19-13-36-22(21(19)30)15-6-8-16(9-7-15)25(2,3)4)27-28-24(35)26-17-10-11-18(23(31)34-5)20(12-17)29(32)33/h6-13,30H,1-5H3,(H2,26,28,35)/b27-14+ |
| InChIKey | RPJLRVZFQHBIBD-MZJWZYIUSA-N |
| XLogP | 5.82 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|