C24H27N3O6S — CID 172972438
[5-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-2-carboxyphenyl]-oxidoazanium;hydrate (PubChem CID 172972438) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is [5-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-2-carboxyphenyl]-oxidoazanium;hydrate.
| Compound Name | [5-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-2-carboxyphenyl]-oxidoazanium;hydrate |
|---|---|
| PubChem CID | 172972438 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [5-[[(E)-1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]-2-carboxyphenyl]-oxidoazanium;hydrate |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)O)c([NH2+][O-])c1)c1csc(-c2ccc(C(C)(C)C)cc2)c1O.O |
| InChI | InChI=1S/C24H25N3O5S.H2O/c1-13(25-26-22(29)15-7-10-17(23(30)31)19(11-15)27-32)18-12-33-21(20(18)28)14-5-8-16(9-6-14)24(2,3)4;/h5-12,28H,27H2,1-4H3,(H,26,29)(H,30,31);1H2/b25-13+; |
| InChIKey | GVXINCLFVJOYTN-FEIRLWDVSA-N |
| XLogP | 3.14 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|