C27H29NO4S — CID 123289452
2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-1-(3,4-dimethylphenyl)ethanone;carbon dioxide (PubChem CID 123289452) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is 2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-1-(3,4-dimethylphenyl)ethanone;carbon dioxide.
| Compound Name | 2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-1-(3,4-dimethylphenyl)ethanone;carbon dioxide |
|---|---|
| PubChem CID | 123289452 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-1-(3,4-dimethylphenyl)ethanone;carbon dioxide |
| SMILES | C/C(=N\CC(=O)c1ccc(C)c(C)c1)c1csc(-c2ccc(C(C)(C)C)cc2)c1O.O=C=O |
| InChI | InChI=1S/C26H29NO2S.CO2/c1-16-7-8-20(13-17(16)2)23(28)14-27-18(3)22-15-30-25(24(22)29)19-9-11-21(12-10-19)26(4,5)6;2-1-3/h7-13,15,29H,14H2,1-6H3;/b27-18+; |
| InChIKey | NURLFKAEWHDSKM-ZEJCXCISSA-N |
| XLogP | 6.14 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|