C32H32N2O4S2 — CID 159298206
4-[3-[5-[2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]benzamide (PubChem CID 159298206) has the molecular formula C32H32N2O4S2 and a molecular weight of 572.75 g/mol. Its IUPAC name is 4-[3-[5-[2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]benzamide.
| Compound Name | 4-[3-[5-[2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 159298206 |
| Molecular Formula | C32H32N2O4S2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 4-[3-[5-[2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]benzamide |
| SMILES | C/C(=N\CC(=O)c1ccc(C(=O)CCc2ccc(C(N)=O)cc2)s1)c1csc(-c2ccc(C(C)(C)C)cc2)c1O |
| InChI | InChI=1S/C32H32N2O4S2/c1-19(24-18-39-30(29(24)37)21-10-12-23(13-11-21)32(2,3)4)34-17-26(36)28-16-15-27(40-28)25(35)14-7-20-5-8-22(9-6-20)31(33)38/h5-6,8-13,15-16,18,37H,7,14,17H2,1-4H3,(H2,33,38)/b34-19+ |
| InChIKey | JOWHOLCHLLTVPG-ALQBTCKLSA-N |
| XLogP | 7.09 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|