C26H26BrNO4S — CID 123764362
1-(3-bromo-4-methylphenyl)-2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]ethanone;carbon dioxide (PubChem CID 123764362) has the molecular formula C26H26BrNO4S and a molecular weight of 528.47 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]ethanone;carbon dioxide.
| Compound Name | 1-(3-bromo-4-methylphenyl)-2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]ethanone;carbon dioxide |
|---|---|
| PubChem CID | 123764362 |
| Molecular Formula | C26H26BrNO4S |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-2-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]ethanone;carbon dioxide |
| SMILES | C/C(=N\CC(=O)c1ccc(C)c(Br)c1)c1csc(-c2ccc(C(C)(C)C)cc2)c1O.O=C=O |
| InChI | InChI=1S/C25H26BrNO2S.CO2/c1-15-6-7-18(12-21(15)26)22(28)13-27-16(2)20-14-30-24(23(20)29)17-8-10-19(11-9-17)25(3,4)5;2-1-3/h6-12,14,29H,13H2,1-5H3;/b27-16+; |
| InChIKey | XMBWVEGJEYKQPZ-JTCQIRNMSA-N |
| XLogP | 6.60 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|