C33H33BrN2O6S2 — CID 157208215
4-[3-[5-[2-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]-N-[2-(2-methoxyethoxy)ethyl]benzamide (PubChem CID 157208215) has the molecular formula C33H33BrN2O6S2 and a molecular weight of 697.67 g/mol. Its IUPAC name is 4-[3-[5-[2-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]-N-[2-(2-methoxyethoxy)ethyl]benzamide.
| Compound Name | 4-[3-[5-[2-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]-N-[2-(2-methoxyethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 157208215 |
| Molecular Formula | C33H33BrN2O6S2 |
| Molecular Weight | 697.67 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | 4-[3-[5-[2-[1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-oxopropyl]-N-[2-(2-methoxyethoxy)ethyl]benzamide |
| SMILES | COCCOCCNC(=O)c1ccc(CCC(=O)c2ccc(C(=O)C/N=C(\C)c3csc(-c4ccc(Br)cc4)c3O)s2)cc1 |
| InChI | InChI=1S/C33H33BrN2O6S2/c1-21(26-20-43-32(31(26)39)23-8-10-25(34)11-9-23)36-19-28(38)30-14-13-29(44-30)27(37)12-5-22-3-6-24(7-4-22)33(40)35-15-16-42-18-17-41-2/h3-4,6-11,13-14,20,39H,5,12,15-19H2,1-2H3,(H,35,40)/b36-21+ |
| InChIKey | NHQGKBNTKCOZNV-QLQYKETESA-N |
| XLogP | 6.84 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|