C36H43N5O6S2 — CID 78107502
5-N-[[4-[2-[bis(2-hydroxyethyl)amino]ethylcarbamoyl]phenyl]methyl]-2-N-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide (PubChem CID 78107502) has the molecular formula C36H43N5O6S2 and a molecular weight of 705.90 g/mol. Its IUPAC name is 5-N-[[4-[2-[bis(2-hydroxyethyl)amino]ethylcarbamoyl]phenyl]methyl]-2-N-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide.
| Compound Name | 5-N-[[4-[2-[bis(2-hydroxyethyl)amino]ethylcarbamoyl]phenyl]methyl]-2-N-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 78107502 |
| Molecular Formula | C36H43N5O6S2 |
| Molecular Weight | 705.90 g/mol |
| Exact Mass | 705.27 |
| IUPAC Name | 5-N-[[4-[2-[bis(2-hydroxyethyl)amino]ethylcarbamoyl]phenyl]methyl]-2-N-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)NCc2ccc(C(=O)NCCN(CCO)CCO)cc2)s1)c1csc(-c2ccc(C(C)(C)C)cc2)c1O |
| InChI | InChI=1S/C36H43N5O6S2/c1-23(28-22-48-32(31(28)44)25-9-11-27(12-10-25)36(2,3)4)39-40-35(47)30-14-13-29(49-30)34(46)38-21-24-5-7-26(8-6-24)33(45)37-15-16-41(17-19-42)18-20-43/h5-14,22,42-44H,15-21H2,1-4H3,(H,37,45)(H,38,46)(H,40,47) |
| InChIKey | GNZFGWMQSYNPQG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 163.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|