C29H28N4O3S2 — CID 88852719
2-N-[(Z)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-5-N-(2-pyridin-4-ylethyl)thiophene-2,5-dicarboxamide (PubChem CID 88852719) has the molecular formula C29H28N4O3S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2-N-[(Z)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-5-N-(2-pyridin-4-ylethyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[(Z)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-5-N-(2-pyridin-4-ylethyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 88852719 |
| Molecular Formula | C29H28N4O3S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 2-N-[(Z)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]-5-N-(2-pyridin-4-ylethyl)thiophene-2,5-dicarboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(C(=O)NCCc2ccncc2)s1)c1csc(-c2ccc3c(c2)CCCC3)c1O |
| InChI | InChI=1S/C29H28N4O3S2/c1-18(23-17-37-27(26(23)34)22-7-6-20-4-2-3-5-21(20)16-22)32-33-29(36)25-9-8-24(38-25)28(35)31-15-12-19-10-13-30-14-11-19/h6-11,13-14,16-17,34H,2-5,12,15H2,1H3,(H,31,35)(H,33,36)/b32-18- |
| InChIKey | JQAJGGZFZDTTQF-CAQPMQTCSA-N |
| XLogP | 5.58 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|