C24H29N3O3S2 — CID 88864056
methyl 1-[[(E)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylate (PubChem CID 88864056) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is methyl 1-[[(E)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[(E)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 88864056 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | methyl 1-[[(E)-1-[4-hydroxy-5-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophen-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=S)N/N=C(\C)c2csc(-c3ccc4c(c3)CCCC4)c2O)CC1 |
| InChI | InChI=1S/C24H29N3O3S2/c1-15(25-26-24(31)27-11-9-17(10-12-27)23(29)30-2)20-14-32-22(21(20)28)19-8-7-16-5-3-4-6-18(16)13-19/h7-8,13-14,17,28H,3-6,9-12H2,1-2H3,(H,26,31)/b25-15+ |
| InChIKey | SPMAPRCLGBGZKT-MFKUBSTISA-N |
| XLogP | 4.48 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|