C22H27N3O3S2 — CID 87655212
methyl 1-[[5-(3,4-dimethylphenyl)-4-hydroxythiophen-3-yl]-(ethylideneamino)carbamothioyl]piperidine-4-carboxylate (PubChem CID 87655212) has the molecular formula C22H27N3O3S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is methyl 1-[[5-(3,4-dimethylphenyl)-4-hydroxythiophen-3-yl]-(ethylideneamino)carbamothioyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[5-(3,4-dimethylphenyl)-4-hydroxythiophen-3-yl]-(ethylideneamino)carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 87655212 |
| Molecular Formula | C22H27N3O3S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | methyl 1-[[5-(3,4-dimethylphenyl)-4-hydroxythiophen-3-yl]-(ethylideneamino)carbamothioyl]piperidine-4-carboxylate |
| SMILES | CC=NN(C(=S)N1CCC(C(=O)OC)CC1)c1csc(-c2ccc(C)c(C)c2)c1O |
| InChI | InChI=1S/C22H27N3O3S2/c1-5-23-25(22(29)24-10-8-16(9-11-24)21(27)28-4)18-13-30-20(19(18)26)17-7-6-14(2)15(3)12-17/h5-7,12-13,16,26H,8-11H2,1-4H3 |
| InChIKey | KFJINRNQYRUYFG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|