About methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate
methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate (PubChem CID 14204751) has the molecular formula C24H30O4
and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate |
| PubChem CID | 14204751 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(c2cc(C)c(O)c(C)c2)(c2cc(C)c(O)c(C)c2)CC1 |
| InChI | InChI=1S/C24H30O4/c1-14-10-19(11-15(2)21(14)25)24(8-6-18(7-9-24)23(27)28-5)20-12-16(3)22(26)17(4)13-20/h10-13,18,25-26H,6-9H2,1-5H3 |
| InChIKey | SHFHIIIQSRLAET-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate?
The IUPAC name of methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate (CID 14204751) is methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate is COC(=O)C1CCC(c2cc(C)c(O)c(C)c2)(c2cc(C)c(O)c(C)c2)CC1.
What is the InChIKey of methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate?
The InChIKey is SHFHIIIQSRLAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O4/c1-14-10-19(11-15(2)21(14)25)24(8-6-18(7-9-24)23(27)28-5)20-12-16(3)22(26)17(4)13-20/h10-13,18,25-26H,6-9H2,1-5H3.
What are the key properties of methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate?
methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate has a molecular weight of 382.50 g/mol, XLogP of 4.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,4-bis(4-hydroxy-3,5-dimethylphenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 14204751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).