C31H23I7O4 — CID 142305595
2-iodo-6-methyl-4-[1,4,4-tris(4-hydroxy-3,5-diiodophenyl)cyclohexyl]phenol (PubChem CID 142305595) has the molecular formula C31H23I7O4 and a molecular weight of 1347.85 g/mol. Its IUPAC name is 2-iodo-6-methyl-4-[1,4,4-tris(4-hydroxy-3,5-diiodophenyl)cyclohexyl]phenol.
| Compound Name | 2-iodo-6-methyl-4-[1,4,4-tris(4-hydroxy-3,5-diiodophenyl)cyclohexyl]phenol |
|---|---|
| PubChem CID | 142305595 |
| Molecular Formula | C31H23I7O4 |
| Molecular Weight | 1347.85 g/mol |
| Exact Mass | 1347.49 |
| IUPAC Name | 2-iodo-6-methyl-4-[1,4,4-tris(4-hydroxy-3,5-diiodophenyl)cyclohexyl]phenol |
| SMILES | Cc1cc(C2(c3cc(I)c(O)c(I)c3)CCC(c3cc(I)c(O)c(I)c3)(c3cc(I)c(O)c(I)c3)CC2)cc(I)c1O |
| InChI | InChI=1S/C31H23I7O4/c1-14-6-15(7-19(32)26(14)39)30(16-8-20(33)27(40)21(34)9-16)2-4-31(5-3-30,17-10-22(35)28(41)23(36)11-17)18-12-24(37)29(42)25(38)13-18/h6-13,39-42H,2-5H2,1H3 |
| InChIKey | FDWNLQRDKJFAIJ-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1347.85 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|