C26H22Cl2N4O3S2 — CID 73225133
2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(3-pyridin-4-ylpropyl)thiophene-2,5-dicarboxamide (PubChem CID 73225133) has the molecular formula C26H22Cl2N4O3S2 and a molecular weight of 573.53 g/mol. Its IUPAC name is 2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(3-pyridin-4-ylpropyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(3-pyridin-4-ylpropyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 73225133 |
| Molecular Formula | C26H22Cl2N4O3S2 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | 2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(3-pyridin-4-ylpropyl)thiophene-2,5-dicarboxamide |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)NCCCc2ccncc2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C26H22Cl2N4O3S2/c1-15(18-14-36-24(23(18)33)17-4-5-19(27)20(28)13-17)31-32-26(35)22-7-6-21(37-22)25(34)30-10-2-3-16-8-11-29-12-9-16/h4-9,11-14,33H,2-3,10H2,1H3,(H,30,34)(H,32,35) |
| InChIKey | PDXUJDVQFAQKOX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|