C24H21Cl2N5O3S2 — CID 73225214
2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-[(1,5-dimethylpyrazol-3-yl)methyl]thiophene-2,5-dicarboxamide (PubChem CID 73225214) has the molecular formula C24H21Cl2N5O3S2 and a molecular weight of 562.50 g/mol. Its IUPAC name is 2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-[(1,5-dimethylpyrazol-3-yl)methyl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-[(1,5-dimethylpyrazol-3-yl)methyl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 73225214 |
| Molecular Formula | C24H21Cl2N5O3S2 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | 2-N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-[(1,5-dimethylpyrazol-3-yl)methyl]thiophene-2,5-dicarboxamide |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)NCc2cc(C)n(C)n2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C24H21Cl2N5O3S2/c1-12-8-15(30-31(12)3)10-27-23(33)19-6-7-20(36-19)24(34)29-28-13(2)16-11-35-22(21(16)32)14-4-5-17(25)18(26)9-14/h4-9,11,32H,10H2,1-3H3,(H,27,33)(H,29,34) |
| InChIKey | KNBDMORGFIFMHW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|