C25H24Cl2N4O3S2 — CID 173499633
N-(4-amino-2-oxobut-3-enyl)-5-[1-[(2E)-2-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylidene]hydrazinyl]-2-methylprop-1-enyl]thiophene-2-carboxamide (PubChem CID 173499633) has the molecular formula C25H24Cl2N4O3S2 and a molecular weight of 563.53 g/mol. Its IUPAC name is N-(4-amino-2-oxobut-3-enyl)-5-[1-[(2E)-2-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylidene]hydrazinyl]-2-methylprop-1-enyl]thiophene-2-carboxamide.
| Compound Name | N-(4-amino-2-oxobut-3-enyl)-5-[1-[(2E)-2-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylidene]hydrazinyl]-2-methylprop-1-enyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 173499633 |
| Molecular Formula | C25H24Cl2N4O3S2 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | N-(4-amino-2-oxobut-3-enyl)-5-[1-[(2E)-2-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylidene]hydrazinyl]-2-methylprop-1-enyl]thiophene-2-carboxamide |
| SMILES | CC(C)=C(N/N=C(\C)c1csc(-c2ccc(Cl)c(Cl)c2)c1O)c1ccc(C(=O)NCC(=O)C=CN)s1 |
| InChI | InChI=1S/C25H24Cl2N4O3S2/c1-13(2)22(20-6-7-21(36-20)25(34)29-11-16(32)8-9-28)31-30-14(3)17-12-35-24(23(17)33)15-4-5-18(26)19(27)10-15/h4-10,12,31,33H,11,28H2,1-3H3,(H,29,34)/b9-8?,30-14+ |
| InChIKey | KJNMLSJORBTTRH-UICFMKGISA-N |
| XLogP | 6.03 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|