C25H27NO3S3 — CID 58209668
methyl 5-[3-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]thiophene-2-carboxylate (PubChem CID 58209668) has the molecular formula C25H27NO3S3 and a molecular weight of 485.70 g/mol. Its IUPAC name is methyl 5-[3-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 58209668 |
| Molecular Formula | C25H27NO3S3 |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | methyl 5-[3-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-sulfanylidenepropyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CC(=S)C/N=C(\C)c2csc(-c3ccc(C(C)(C)C)cc3)c2O)s1 |
| InChI | InChI=1S/C25H27NO3S3/c1-15(26-13-18(30)12-19-10-11-21(32-19)24(28)29-5)20-14-31-23(22(20)27)16-6-8-17(9-7-16)25(2,3)4/h6-11,14,27H,12-13H2,1-5H3/b26-15+ |
| InChIKey | HEKQMBPMDUZTRJ-CVKSISIWSA-N |
| XLogP | 6.69 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|