C26H28N2O4S — CID 59693166
4-[[(E)-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]-2-methylpropylidene]amino]carbamoyl]benzoic acid (PubChem CID 59693166) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[[(E)-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]-2-methylpropylidene]amino]carbamoyl]benzoic acid.
| Compound Name | 4-[[(E)-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]-2-methylpropylidene]amino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 59693166 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-[[(E)-[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]-2-methylpropylidene]amino]carbamoyl]benzoic acid |
| SMILES | CC(C)/C(=N\NC(=O)c1ccc(C(=O)O)cc1)c1csc(-c2ccc(C(C)(C)C)cc2)c1O |
| InChI | InChI=1S/C26H28N2O4S/c1-15(2)21(27-28-24(30)17-6-8-18(9-7-17)25(31)32)20-14-33-23(22(20)29)16-10-12-19(13-11-16)26(3,4)5/h6-15,29H,1-5H3,(H,28,30)(H,31,32)/b27-21+ |
| InChIKey | UWWQZHGFMOUVTF-SZXQPVLSSA-N |
| XLogP | 5.91 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|