C23H22F3N3O3S2 — CID 89385248
2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]propylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide (PubChem CID 89385248) has the molecular formula C23H22F3N3O3S2 and a molecular weight of 509.58 g/mol. Its IUPAC name is 2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]propylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]propylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 89385248 |
| Molecular Formula | C23H22F3N3O3S2 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 2-N-[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]propylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide |
| SMILES | CC/C(=N\NC(=O)c1ccc(C(=O)NC(C)C)s1)c1csc(-c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C23H22F3N3O3S2/c1-4-16(28-29-22(32)18-10-9-17(34-18)21(31)27-12(2)3)15-11-33-20(19(15)30)13-5-7-14(8-6-13)23(24,25)26/h5-12,30H,4H2,1-3H3,(H,27,31)(H,29,32)/b28-16+ |
| InChIKey | WASVDLMYDGUIKO-LQKURTRISA-N |
| XLogP | 5.88 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|