C22H22F3N5O3S — CID 76597848
2-N-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide (PubChem CID 76597848) has the molecular formula C22H22F3N5O3S and a molecular weight of 493.51 g/mol. Its IUPAC name is 2-N-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 76597848 |
| Molecular Formula | C22H22F3N5O3S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-N-[1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]-5-N-propan-2-ylthiophene-2,5-dicarboxamide |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)NC(C)C)s1)c1nn(C)c(-c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C22H22F3N5O3S/c1-11(2)26-20(32)15-9-10-16(34-15)21(33)28-27-12(3)17-19(31)18(30(4)29-17)13-5-7-14(8-6-13)22(23,24)25/h5-11,31H,1-4H3,(H,26,32)(H,28,33) |
| InChIKey | GEFQJFWQYOKNFQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|