C23H24F3N5O3S — CID 87322188
2-N,2-N-diethyl-5-N-[(Z)-1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide (PubChem CID 87322188) has the molecular formula C23H24F3N5O3S and a molecular weight of 507.54 g/mol. Its IUPAC name is 2-N,2-N-diethyl-5-N-[(Z)-1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,2-N-diethyl-5-N-[(Z)-1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 87322188 |
| Molecular Formula | C23H24F3N5O3S |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-N,2-N-diethyl-5-N-[(Z)-1-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)N/N=C(/C)c2nn(C)c(-c3ccc(C(F)(F)F)cc3)c2O)s1 |
| InChI | InChI=1S/C23H24F3N5O3S/c1-5-31(6-2)22(34)17-12-11-16(35-17)21(33)28-27-13(3)18-20(32)19(30(4)29-18)14-7-9-15(10-8-14)23(24,25)26/h7-12,32H,5-6H2,1-4H3,(H,28,33)/b27-13- |
| InChIKey | PMVLNROORGMZCF-WKIKZPBSSA-N |
| XLogP | 4.51 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|