C22H22F3N5O4S — CID 67243039
2-N-(ethylideneamino)-2-N-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]-5-N-(2-methoxyethyl)thiophene-2,5-dicarboxamide (PubChem CID 67243039) has the molecular formula C22H22F3N5O4S and a molecular weight of 509.51 g/mol. Its IUPAC name is 2-N-(ethylideneamino)-2-N-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]-5-N-(2-methoxyethyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(ethylideneamino)-2-N-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]-5-N-(2-methoxyethyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 67243039 |
| Molecular Formula | C22H22F3N5O4S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 2-N-(ethylideneamino)-2-N-[4-hydroxy-1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]-5-N-(2-methoxyethyl)thiophene-2,5-dicarboxamide |
| SMILES | CC=NN(C(=O)c1ccc(C(=O)NCCOC)s1)c1nn(C)c(-c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C22H22F3N5O4S/c1-4-27-30(21(33)16-10-9-15(35-16)20(32)26-11-12-34-3)19-18(31)17(29(2)28-19)13-5-7-14(8-6-13)22(23,24)25/h4-10,31H,11-12H2,1-3H3,(H,26,32) |
| InChIKey | BUAMIRYMBFGPMV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|