C16H14F3N3O2S — CID 134800055
N-(2-methoxyethyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134800055) has the molecular formula C16H14F3N3O2S and a molecular weight of 369.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 134800055 |
| Molecular Formula | C16H14F3N3O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-(2-methoxyethyl)-5-[3-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | COCCNC(=O)c1nc2sccn2c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3N3O2S/c1-24-7-5-20-14(23)12-13(22-6-8-25-15(22)21-12)10-3-2-4-11(9-10)16(17,18)19/h2-4,6,8-9H,5,7H2,1H3,(H,20,23) |
| InChIKey | SEXDMAPJAPQBHR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|