C15H16N4O2S — CID 134797519
N-(3-methoxypropyl)-5-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134797519) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-(3-methoxypropyl)-5-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 134797519 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(3-methoxypropyl)-5-pyridin-3-ylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | COCCCNC(=O)c1nc2sccn2c1-c1cccnc1 |
| InChI | InChI=1S/C15H16N4O2S/c1-21-8-3-6-17-14(20)12-13(11-4-2-5-16-10-11)19-7-9-22-15(19)18-12/h2,4-5,7,9-10H,3,6,8H2,1H3,(H,17,20) |
| InChIKey | XZCSYBFNPFQTGC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|