C22H24F3N5O4S — CID 162582833
5-[[[3-amino-5-methylimino-4-oxo-5-[4-(trifluoromethyl)phenyl]pent-2-en-2-yl]amino]carbamoyl]-N-(2-methoxyethyl)thiophene-2-carboxamide (PubChem CID 162582833) has the molecular formula C22H24F3N5O4S and a molecular weight of 511.53 g/mol. Its IUPAC name is 5-[[[3-amino-5-methylimino-4-oxo-5-[4-(trifluoromethyl)phenyl]pent-2-en-2-yl]amino]carbamoyl]-N-(2-methoxyethyl)thiophene-2-carboxamide.
| Compound Name | 5-[[[3-amino-5-methylimino-4-oxo-5-[4-(trifluoromethyl)phenyl]pent-2-en-2-yl]amino]carbamoyl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162582833 |
| Molecular Formula | C22H24F3N5O4S |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 5-[[[3-amino-5-methylimino-4-oxo-5-[4-(trifluoromethyl)phenyl]pent-2-en-2-yl]amino]carbamoyl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
| SMILES | C/N=C(/C(=O)C(N)=C(C)NNC(=O)c1ccc(C(=O)NCCOC)s1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H24F3N5O4S/c1-12(29-30-21(33)16-9-8-15(35-16)20(32)28-10-11-34-3)17(26)19(31)18(27-2)13-4-6-14(7-5-13)22(23,24)25/h4-9,29H,10-11,26H2,1-3H3,(H,28,32)(H,30,33)/b17-12?,27-18+ |
| InChIKey | YCVSZRBTXUPBSS-LKKFLZJGSA-N |
| XLogP | 2.26 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|