C25H25NO4S — CID 123975290
2-[[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]methylideneamino]-1-(4-methylphenyl)ethanone;carbon dioxide (PubChem CID 123975290) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]methylideneamino]-1-(4-methylphenyl)ethanone;carbon dioxide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]methylideneamino]-1-(4-methylphenyl)ethanone;carbon dioxide |
|---|---|
| PubChem CID | 123975290 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]methylideneamino]-1-(4-methylphenyl)ethanone;carbon dioxide |
| SMILES | Cc1ccc(C(=O)C/N=C/c2csc(-c3ccc(C(C)(C)C)cc3)c2O)cc1.O=C=O |
| InChI | InChI=1S/C24H25NO2S.CO2/c1-16-5-7-17(8-6-16)21(26)14-25-13-19-15-28-23(22(19)27)18-9-11-20(12-10-18)24(2,3)4;2-1-3/h5-13,15,27H,14H2,1-4H3;/b25-13+; |
| InChIKey | YUIKTPLJGCZQBE-FEIRLWDVSA-N |
| XLogP | 5.44 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|