C20H17Cl2N5O3S — CID 11213740
4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]benzoic acid (PubChem CID 11213740) has the molecular formula C20H17Cl2N5O3S and a molecular weight of 478.36 g/mol. Its IUPAC name is 4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]benzoic acid.
| Compound Name | 4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 11213740 |
| Molecular Formula | C20H17Cl2N5O3S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
| SMILES | C/C(=N/NC(=S)Nc1ccc(C(=O)O)cc1)c1nn(C)c(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C20H17Cl2N5O3S/c1-10(24-25-20(31)23-13-6-3-11(4-7-13)19(29)30)16-18(28)17(27(2)26-16)12-5-8-14(21)15(22)9-12/h3-9,28H,1-2H3,(H,29,30)(H2,23,25,31)/b24-10- |
| InChIKey | NCXYYZSZSIBPTL-VROXFSQNSA-N |
| XLogP | 4.51 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|