C19H16Cl2N4O4 — CID 136617919
N-[1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-3,4-dihydroxybenzamide (PubChem CID 136617919) has the molecular formula C19H16Cl2N4O4 and a molecular weight of 435.27 g/mol. Its IUPAC name is N-[1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-3,4-dihydroxybenzamide.
| Compound Name | N-[1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 136617919 |
| Molecular Formula | C19H16Cl2N4O4 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-[1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]-3,4-dihydroxybenzamide |
| SMILES | CC(=NNC(=O)c1ccc(O)c(O)c1)c1nn(C)c(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C19H16Cl2N4O4/c1-9(22-23-19(29)11-4-6-14(26)15(27)8-11)16-18(28)17(25(2)24-16)10-3-5-12(20)13(21)7-10/h3-8,26-28H,1-2H3,(H,23,29) |
| InChIKey | NHJYFRDNBWSSFH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|