C24H23N5O6 — CID 88863981
methyl 4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoate (PubChem CID 88863981) has the molecular formula C24H23N5O6 and a molecular weight of 477.48 g/mol. Its IUPAC name is methyl 4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoate.
| Compound Name | methyl 4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 88863981 |
| Molecular Formula | C24H23N5O6 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | methyl 4-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoate |
| SMILES | COC(=O)c1ccc(C(=O)N/N=C(\C)c2nn(C)c(-c3ccc4c(c3)CCC4)c2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23N5O6/c1-13(25-26-23(31)17-9-10-18(24(32)35-3)19(12-17)29(33)34)20-22(30)21(28(2)27-20)16-8-7-14-5-4-6-15(14)11-16/h7-12,30H,4-6H2,1-3H3,(H,26,31)/b25-13+ |
| InChIKey | RQJFIRCYNXUTQO-DHRITJCHSA-N |
| XLogP | 3.13 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|