C15H10F6N2O2 — CID 90317246
2-amino-N-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 90317246) has the molecular formula C15H10F6N2O2 and a molecular weight of 364.25 g/mol. Its IUPAC name is 2-amino-N-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90317246 |
| Molecular Formula | C15H10F6N2O2 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-amino-N-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | Nc1cc(C(F)(F)F)ccc1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F6N2O2/c16-14(17,18)8-1-6-11(12(22)7-8)13(24)23-9-2-4-10(5-3-9)25-15(19,20)21/h1-7H,22H2,(H,23,24) |
| InChIKey | PPSAKKHQTYPXFO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|