About 2-amino-4-(trifluoromethyl)benzohydrazide;ethane
2-amino-4-(trifluoromethyl)benzohydrazide;ethane (PubChem CID 145124989) has the molecular formula C12H20F3N3O
and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-amino-4-(trifluoromethyl)benzohydrazide;ethane.
Molecular Properties
| Compound Name | 2-amino-4-(trifluoromethyl)benzohydrazide;ethane |
| PubChem CID | 145124989 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-amino-4-(trifluoromethyl)benzohydrazide;ethane |
| SMILES | CC.CC.NNC(=O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C8H8F3N3O.2C2H6/c9-8(10,11)4-1-2-5(6(12)3-4)7(15)14-13;2*1-2/h1-3H,12-13H2,(H,14,15);2*1-2H3 |
| InChIKey | UGWFFOYBVDROPS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(trifluoromethyl)benzohydrazide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(trifluoromethyl)benzohydrazide;ethane?
The IUPAC name of 2-amino-4-(trifluoromethyl)benzohydrazide;ethane (CID 145124989) is 2-amino-4-(trifluoromethyl)benzohydrazide;ethane.
What is the SMILES notation for 2-amino-4-(trifluoromethyl)benzohydrazide;ethane?
The canonical SMILES for 2-amino-4-(trifluoromethyl)benzohydrazide;ethane is CC.CC.NNC(=O)c1ccc(C(F)(F)F)cc1N.
What is the InChIKey of 2-amino-4-(trifluoromethyl)benzohydrazide;ethane?
The InChIKey is UGWFFOYBVDROPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O.2C2H6/c9-8(10,11)4-1-2-5(6(12)3-4)7(15)14-13;2*1-2/h1-3H,12-13H2,(H,14,15);2*1-2H3.
What are the key properties of 2-amino-4-(trifluoromethyl)benzohydrazide;ethane?
2-amino-4-(trifluoromethyl)benzohydrazide;ethane has a molecular weight of 279.31 g/mol, XLogP of 2.94, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(trifluoromethyl)benzohydrazide;ethane is sourced from PubChem (CID 145124989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).