C15H15F3N4O3S — CID 146093858
2-amino-N-[2-(methylamino)-5-sulfamoylphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 146093858) has the molecular formula C15H15F3N4O3S and a molecular weight of 388.37 g/mol. Its IUPAC name is 2-amino-N-[2-(methylamino)-5-sulfamoylphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-(methylamino)-5-sulfamoylphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 146093858 |
| Molecular Formula | C15H15F3N4O3S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-amino-N-[2-(methylamino)-5-sulfamoylphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | CNc1ccc(S(N)(=O)=O)cc1NC(=O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C15H15F3N4O3S/c1-21-12-5-3-9(26(20,24)25)7-13(12)22-14(23)10-4-2-8(6-11(10)19)15(16,17)18/h2-7,21H,19H2,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | MHAUAADENMYXRK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|