C17H17F3N2OS — CID 118035480
2-ethyl-N-[2-(methylamino)-5-(trifluoromethyl)phenyl]-3-sulfanylbenzamide (PubChem CID 118035480) has the molecular formula C17H17F3N2OS and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-ethyl-N-[2-(methylamino)-5-(trifluoromethyl)phenyl]-3-sulfanylbenzamide.
| Compound Name | 2-ethyl-N-[2-(methylamino)-5-(trifluoromethyl)phenyl]-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 118035480 |
| Molecular Formula | C17H17F3N2OS |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-ethyl-N-[2-(methylamino)-5-(trifluoromethyl)phenyl]-3-sulfanylbenzamide |
| SMILES | CCc1c(S)cccc1C(=O)Nc1cc(C(F)(F)F)ccc1NC |
| InChI | InChI=1S/C17H17F3N2OS/c1-3-11-12(5-4-6-15(11)24)16(23)22-14-9-10(17(18,19)20)7-8-13(14)21-2/h4-9,21,24H,3H2,1-2H3,(H,22,23) |
| InChIKey | CWHPEHCVKWUGGK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|