C14H18F3N3O2 — CID 119707017
N-[2-acetamido-5-(trifluoromethyl)phenyl]-2-methyl-3-(methylamino)propanamide (PubChem CID 119707017) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[2-acetamido-5-(trifluoromethyl)phenyl]-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[2-acetamido-5-(trifluoromethyl)phenyl]-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 119707017 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-acetamido-5-(trifluoromethyl)phenyl]-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)Nc1cc(C(F)(F)F)ccc1NC(C)=O |
| InChI | InChI=1S/C14H18F3N3O2/c1-8(7-18-3)13(22)20-12-6-10(14(15,16)17)4-5-11(12)19-9(2)21/h4-6,8,18H,7H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | BREOPAJZNFNSLD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |